C18H14BrNO2 — CID 174474901
8-bromo-10-nitro-1,2,11,12-tetrahydrochrysene (PubChem CID 174474901) has the molecular formula C18H14BrNO2 and a molecular weight of 356.22 g/mol. Its IUPAC name is 8-bromo-10-nitro-1,2,11,12-tetrahydrochrysene.
| Compound Name | 8-bromo-10-nitro-1,2,11,12-tetrahydrochrysene |
|---|---|
| PubChem CID | 174474901 |
| Molecular Formula | C18H14BrNO2 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 8-bromo-10-nitro-1,2,11,12-tetrahydrochrysene |
| SMILES | O=[N+]([O-])c1cc(Br)cc2ccc3c(c12)CCC1=C3C=CCC1 |
| InChI | InChI=1S/C18H14BrNO2/c19-13-9-12-6-7-15-14-4-2-1-3-11(14)5-8-16(15)18(12)17(10-13)20(21)22/h2,4,6-7,9-10H,1,3,5,8H2 |
| InChIKey | QJLRNFOOQNGJQI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|