About decyl(triethyl)azanium;ethenoxy-oxido-oxophosphanium
decyl(triethyl)azanium;ethenoxy-oxido-oxophosphanium (PubChem CID 174475382) has the molecular formula C18H39NO3P+
and a molecular weight of 348.49 g/mol. Its IUPAC name is decyl(triethyl)azanium;ethenoxy-oxido-oxophosphanium.
Molecular Properties
| Compound Name | decyl(triethyl)azanium;ethenoxy-oxido-oxophosphanium |
| PubChem CID | 174475382 |
| Molecular Formula | C18H39NO3P+ |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | decyl(triethyl)azanium;ethenoxy-oxido-oxophosphanium |
| SMILES | C=CO[P+](=O)[O-].CCCCCCCCCC[N+](CC)(CC)CC |
| InChI | InChI=1S/C16H36N.C2H3O3P/c1-5-9-10-11-12-13-14-15-16-17(6-2,7-3)8-4;1-2-5-6(3)4/h5-16H2,1-4H3;2H,1H2/q+1; |
| InChIKey | NROKFQNUDRUCQE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze decyl(triethyl)azanium;ethenoxy-oxido-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl(triethyl)azanium;ethenoxy-oxido-oxophosphanium?
The IUPAC name of decyl(triethyl)azanium;ethenoxy-oxido-oxophosphanium (CID 174475382) is decyl(triethyl)azanium;ethenoxy-oxido-oxophosphanium.
What is the SMILES notation for decyl(triethyl)azanium;ethenoxy-oxido-oxophosphanium?
The canonical SMILES for decyl(triethyl)azanium;ethenoxy-oxido-oxophosphanium is C=CO[P+](=O)[O-].CCCCCCCCCC[N+](CC)(CC)CC.
What is the InChIKey of decyl(triethyl)azanium;ethenoxy-oxido-oxophosphanium?
The InChIKey is NROKFQNUDRUCQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.C2H3O3P/c1-5-9-10-11-12-13-14-15-16-17(6-2,7-3)8-4;1-2-5-6(3)4/h5-16H2,1-4H3;2H,1H2/q+1;.
What are the key properties of decyl(triethyl)azanium;ethenoxy-oxido-oxophosphanium?
decyl(triethyl)azanium;ethenoxy-oxido-oxophosphanium has a molecular weight of 348.49 g/mol, XLogP of 5.17, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for decyl(triethyl)azanium;ethenoxy-oxido-oxophosphanium is sourced from PubChem (CID 174475382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).