About methyl N-(2,5-dioxopyrrol-1-yl)carbamate
methyl N-(2,5-dioxopyrrol-1-yl)carbamate (PubChem CID 174476304) has the molecular formula C6H6N2O4
and a molecular weight of 170.12 g/mol. Its IUPAC name is methyl N-(2,5-dioxopyrrol-1-yl)carbamate.
Molecular Properties
| Compound Name | methyl N-(2,5-dioxopyrrol-1-yl)carbamate |
| PubChem CID | 174476304 |
| Molecular Formula | C6H6N2O4 |
| Molecular Weight | 170.12 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | methyl N-(2,5-dioxopyrrol-1-yl)carbamate |
| SMILES | COC(=O)NN1C(=O)C=CC1=O |
| InChI | InChI=1S/C6H6N2O4/c1-12-6(11)7-8-4(9)2-3-5(8)10/h2-3H,1H3,(H,7,11) |
| InChIKey | SIJIGFKNMRKDJH-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.12 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(2,5-dioxopyrrol-1-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(2,5-dioxopyrrol-1-yl)carbamate?
The IUPAC name of methyl N-(2,5-dioxopyrrol-1-yl)carbamate (CID 174476304) is methyl N-(2,5-dioxopyrrol-1-yl)carbamate.
What is the SMILES notation for methyl N-(2,5-dioxopyrrol-1-yl)carbamate?
The canonical SMILES for methyl N-(2,5-dioxopyrrol-1-yl)carbamate is COC(=O)NN1C(=O)C=CC1=O.
What is the InChIKey of methyl N-(2,5-dioxopyrrol-1-yl)carbamate?
The InChIKey is SIJIGFKNMRKDJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O4/c1-12-6(11)7-8-4(9)2-3-5(8)10/h2-3H,1H3,(H,7,11).
What are the key properties of methyl N-(2,5-dioxopyrrol-1-yl)carbamate?
methyl N-(2,5-dioxopyrrol-1-yl)carbamate has a molecular weight of 170.12 g/mol, XLogP of -0.82, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(2,5-dioxopyrrol-1-yl)carbamate is sourced from PubChem (CID 174476304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).