About hydroxymethanone;1,10-phenanthroline-1,10-diide;terbium(3+)
hydroxymethanone;1,10-phenanthroline-1,10-diide;terbium(3+) (PubChem CID 174476784) has the molecular formula C13H9N2O2Tb
and a molecular weight of 384.15 g/mol. Its IUPAC name is hydroxymethanone;1,10-phenanthroline-1,10-diide;terbium(3+).
Molecular Properties
| Compound Name | hydroxymethanone;1,10-phenanthroline-1,10-diide;terbium(3+) |
| PubChem CID | 174476784 |
| Molecular Formula | C13H9N2O2Tb |
| Molecular Weight | 384.15 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | hydroxymethanone;1,10-phenanthroline-1,10-diide;terbium(3+) |
| SMILES | C1=C[N-]c2c3c(ccc2=C1)=CC=C[N-]3.O=[C-]O.[Tb+3] |
| InChI | InChI=1S/C12H8N2.CHO2.Tb/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2-1-3;/h1-8H;(H,2,3);/q-2;-1;+3 |
| InChIKey | HLWUCUGGDHHUAK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.15 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze hydroxymethanone;1,10-phenanthroline-1,10-diide;terbium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxymethanone;1,10-phenanthroline-1,10-diide;terbium(3+)?
The IUPAC name of hydroxymethanone;1,10-phenanthroline-1,10-diide;terbium(3+) (CID 174476784) is hydroxymethanone;1,10-phenanthroline-1,10-diide;terbium(3+).
What is the SMILES notation for hydroxymethanone;1,10-phenanthroline-1,10-diide;terbium(3+)?
The canonical SMILES for hydroxymethanone;1,10-phenanthroline-1,10-diide;terbium(3+) is C1=C[N-]c2c3c(ccc2=C1)=CC=C[N-]3.O=[C-]O.[Tb+3].
What is the InChIKey of hydroxymethanone;1,10-phenanthroline-1,10-diide;terbium(3+)?
The InChIKey is HLWUCUGGDHHUAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.CHO2.Tb/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2-1-3;/h1-8H;(H,2,3);/q-2;-1;+3.
What are the key properties of hydroxymethanone;1,10-phenanthroline-1,10-diide;terbium(3+)?
hydroxymethanone;1,10-phenanthroline-1,10-diide;terbium(3+) has a molecular weight of 384.15 g/mol, XLogP of 1.92, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxymethanone;1,10-phenanthroline-1,10-diide;terbium(3+) is sourced from PubChem (CID 174476784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).