About [7-(2-chlorophenyl)-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-6-yl] acetate
[7-(2-chlorophenyl)-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-6-yl] acetate (PubChem CID 174476799) has the molecular formula C15H12ClN3O3
and a molecular weight of 317.73 g/mol. Its IUPAC name is [7-(2-chlorophenyl)-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-6-yl] acetate.
Molecular Properties
| Compound Name | [7-(2-chlorophenyl)-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-6-yl] acetate |
| PubChem CID | 174476799 |
| Molecular Formula | C15H12ClN3O3 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | [7-(2-chlorophenyl)-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-6-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c2c(=O)[nH]cnc2n1-c1ccccc1Cl |
| InChI | InChI=1S/C15H12ClN3O3/c1-8-12-13(17-7-18-14(12)21)19(15(8)22-9(2)20)11-6-4-3-5-10(11)16/h3-7H,1-2H3,(H,17,18,21) |
| InChIKey | PHITZZLHUVHNNY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [7-(2-chlorophenyl)-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-6-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(2-chlorophenyl)-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-6-yl] acetate?
The IUPAC name of [7-(2-chlorophenyl)-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-6-yl] acetate (CID 174476799) is [7-(2-chlorophenyl)-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-6-yl] acetate.
What is the SMILES notation for [7-(2-chlorophenyl)-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-6-yl] acetate?
The canonical SMILES for [7-(2-chlorophenyl)-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-6-yl] acetate is CC(=O)Oc1c(C)c2c(=O)[nH]cnc2n1-c1ccccc1Cl.
What is the InChIKey of [7-(2-chlorophenyl)-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-6-yl] acetate?
The InChIKey is PHITZZLHUVHNNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClN3O3/c1-8-12-13(17-7-18-14(12)21)19(15(8)22-9(2)20)11-6-4-3-5-10(11)16/h3-7H,1-2H3,(H,17,18,21).
What are the key properties of [7-(2-chlorophenyl)-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-6-yl] acetate?
[7-(2-chlorophenyl)-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-6-yl] acetate has a molecular weight of 317.73 g/mol, XLogP of 2.60, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(2-chlorophenyl)-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-6-yl] acetate is sourced from PubChem (CID 174476799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).