C21H22FN — CID 174476803
1-(5-fluoro-1,7,8,9-tetrahydrochrysen-1-yl)propan-2-amine (PubChem CID 174476803) has the molecular formula C21H22FN and a molecular weight of 307.41 g/mol. Its IUPAC name is 1-(5-fluoro-1,7,8,9-tetrahydrochrysen-1-yl)propan-2-amine.
| Compound Name | 1-(5-fluoro-1,7,8,9-tetrahydrochrysen-1-yl)propan-2-amine |
|---|---|
| PubChem CID | 174476803 |
| Molecular Formula | C21H22FN |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-(5-fluoro-1,7,8,9-tetrahydrochrysen-1-yl)propan-2-amine |
| SMILES | CC(N)CC1C=CC=c2c1ccc1c3c(cc(F)c21)CCCC=3 |
| InChI | InChI=1S/C21H22FN/c1-13(23)11-14-6-4-8-18-17(14)9-10-19-16-7-3-2-5-15(16)12-20(22)21(18)19/h4,6-10,12-14H,2-3,5,11,23H2,1H3 |
| InChIKey | RDLTWVKFNKWJLL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |