About lithium;(3-chloro-2,6-dimethoxyphenyl)-phosphanylmethanone;cyclohexane
lithium;(3-chloro-2,6-dimethoxyphenyl)-phosphanylmethanone;cyclohexane (PubChem CID 174476932) has the molecular formula C15H21ClLiO3P
and a molecular weight of 322.70 g/mol. Its IUPAC name is lithium;(3-chloro-2,6-dimethoxyphenyl)-phosphanylmethanone;cyclohexane.
Molecular Properties
| Compound Name | lithium;(3-chloro-2,6-dimethoxyphenyl)-phosphanylmethanone;cyclohexane |
| PubChem CID | 174476932 |
| Molecular Formula | C15H21ClLiO3P |
| Molecular Weight | 322.70 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | lithium;(3-chloro-2,6-dimethoxyphenyl)-phosphanylmethanone;cyclohexane |
| SMILES | COc1ccc(Cl)c(OC)c1C(=O)P.[CH-]1CCCCC1.[Li+] |
| InChI | InChI=1S/C9H10ClO3P.C6H11.Li/c1-12-6-4-3-5(10)8(13-2)7(6)9(11)14;1-2-4-6-5-3-1;/h3-4H,14H2,1-2H3;1H,2-6H2;/q;-1;+1 |
| InChIKey | VUZOFQWYMWNBER-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.70 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;(3-chloro-2,6-dimethoxyphenyl)-phosphanylmethanone;cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;(3-chloro-2,6-dimethoxyphenyl)-phosphanylmethanone;cyclohexane?
The IUPAC name of lithium;(3-chloro-2,6-dimethoxyphenyl)-phosphanylmethanone;cyclohexane (CID 174476932) is lithium;(3-chloro-2,6-dimethoxyphenyl)-phosphanylmethanone;cyclohexane.
What is the SMILES notation for lithium;(3-chloro-2,6-dimethoxyphenyl)-phosphanylmethanone;cyclohexane?
The canonical SMILES for lithium;(3-chloro-2,6-dimethoxyphenyl)-phosphanylmethanone;cyclohexane is COc1ccc(Cl)c(OC)c1C(=O)P.[CH-]1CCCCC1.[Li+].
What is the InChIKey of lithium;(3-chloro-2,6-dimethoxyphenyl)-phosphanylmethanone;cyclohexane?
The InChIKey is VUZOFQWYMWNBER-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClO3P.C6H11.Li/c1-12-6-4-3-5(10)8(13-2)7(6)9(11)14;1-2-4-6-5-3-1;/h3-4H,14H2,1-2H3;1H,2-6H2;/q;-1;+1.
What are the key properties of lithium;(3-chloro-2,6-dimethoxyphenyl)-phosphanylmethanone;cyclohexane?
lithium;(3-chloro-2,6-dimethoxyphenyl)-phosphanylmethanone;cyclohexane has a molecular weight of 322.70 g/mol, XLogP of 1.53, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;(3-chloro-2,6-dimethoxyphenyl)-phosphanylmethanone;cyclohexane is sourced from PubChem (CID 174476932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).