About CID 174477587
CID 174477587 (PubChem CID 174477587) has the molecular formula C7H12BCl2
and a molecular weight of 177.89 g/mol.
Molecular Properties
| Compound Name | CID 174477587 |
| PubChem CID | 174477587 |
| Molecular Formula | C7H12BCl2 |
| Molecular Weight | 177.89 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | — |
| SMILES | ClC(Cl)[B]C1CCCCC1 |
| InChI | InChI=1S/C7H12BCl2/c9-7(10)8-6-4-2-1-3-5-6/h6-7H,1-5H2 |
| InChIKey | QXLVYJBXJOQWLV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.89 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174477587 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174477587?
The IUPAC name of CID 174477587 (CID 174477587) is not available.
What is the SMILES notation for CID 174477587?
The canonical SMILES for CID 174477587 is ClC(Cl)[B]C1CCCCC1.
What is the InChIKey of CID 174477587?
The InChIKey is QXLVYJBXJOQWLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12BCl2/c9-7(10)8-6-4-2-1-3-5-6/h6-7H,1-5H2.
What are the key properties of CID 174477587?
CID 174477587 has a molecular weight of 177.89 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174477587 is sourced from PubChem (CID 174477587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).