About tert-butyl formate;decylbenzene;ethyl 3-aminothiophene-2-carboxylate
tert-butyl formate;decylbenzene;ethyl 3-aminothiophene-2-carboxylate (PubChem CID 174477791) has the molecular formula C28H45NO4S
and a molecular weight of 491.74 g/mol. Its IUPAC name is tert-butyl formate;decylbenzene;ethyl 3-aminothiophene-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl formate;decylbenzene;ethyl 3-aminothiophene-2-carboxylate |
| PubChem CID | 174477791 |
| Molecular Formula | C28H45NO4S |
| Molecular Weight | 491.74 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | tert-butyl formate;decylbenzene;ethyl 3-aminothiophene-2-carboxylate |
| SMILES | CC(C)(C)OC=O.CCCCCCCCCCc1ccccc1.CCOC(=O)c1sccc1N |
| InChI | InChI=1S/C16H26.C7H9NO2S.C5H10O2/c1-2-3-4-5-6-7-8-10-13-16-14-11-9-12-15-16;1-2-10-7(9)6-5(8)3-4-11-6;1-5(2,3)7-4-6/h9,11-12,14-15H,2-8,10,13H2,1H3;3-4H,2,8H2,1H3;4H,1-3H3 |
| InChIKey | BOICSLCBQBIJFO-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.74 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;decylbenzene;ethyl 3-aminothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;decylbenzene;ethyl 3-aminothiophene-2-carboxylate?
The IUPAC name of tert-butyl formate;decylbenzene;ethyl 3-aminothiophene-2-carboxylate (CID 174477791) is tert-butyl formate;decylbenzene;ethyl 3-aminothiophene-2-carboxylate.
What is the SMILES notation for tert-butyl formate;decylbenzene;ethyl 3-aminothiophene-2-carboxylate?
The canonical SMILES for tert-butyl formate;decylbenzene;ethyl 3-aminothiophene-2-carboxylate is CC(C)(C)OC=O.CCCCCCCCCCc1ccccc1.CCOC(=O)c1sccc1N.
What is the InChIKey of tert-butyl formate;decylbenzene;ethyl 3-aminothiophene-2-carboxylate?
The InChIKey is BOICSLCBQBIJFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26.C7H9NO2S.C5H10O2/c1-2-3-4-5-6-7-8-10-13-16-14-11-9-12-15-16;1-2-10-7(9)6-5(8)3-4-11-6;1-5(2,3)7-4-6/h9,11-12,14-15H,2-8,10,13H2,1H3;3-4H,2,8H2,1H3;4H,1-3H3.
What are the key properties of tert-butyl formate;decylbenzene;ethyl 3-aminothiophene-2-carboxylate?
tert-butyl formate;decylbenzene;ethyl 3-aminothiophene-2-carboxylate has a molecular weight of 491.74 g/mol, XLogP of 7.83, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;decylbenzene;ethyl 3-aminothiophene-2-carboxylate is sourced from PubChem (CID 174477791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).