About hydron;quinazolin-4-amine
hydron;quinazolin-4-amine (PubChem CID 174478214) has the molecular formula C8H8N3+
and a molecular weight of 146.17 g/mol. Its IUPAC name is hydron;quinazolin-4-amine.
Molecular Properties
| Compound Name | hydron;quinazolin-4-amine |
| PubChem CID | 174478214 |
| Molecular Formula | C8H8N3+ |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | hydron;quinazolin-4-amine |
| SMILES | Nc1ncnc2ccccc12.[H+] |
| InChI | InChI=1S/C8H7N3/c9-8-6-3-1-2-4-7(6)10-5-11-8/h1-5H,(H2,9,10,11)/p+1 |
| InChIKey | DRYRBWIFRVMRPV-UHFFFAOYSA-O |
| XLogP | 1.32 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze hydron;quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;quinazolin-4-amine?
The IUPAC name of hydron;quinazolin-4-amine (CID 174478214) is hydron;quinazolin-4-amine.
What is the SMILES notation for hydron;quinazolin-4-amine?
The canonical SMILES for hydron;quinazolin-4-amine is Nc1ncnc2ccccc12.[H+].
What is the InChIKey of hydron;quinazolin-4-amine?
The InChIKey is DRYRBWIFRVMRPV-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H7N3/c9-8-6-3-1-2-4-7(6)10-5-11-8/h1-5H,(H2,9,10,11)/p+1.
What are the key properties of hydron;quinazolin-4-amine?
hydron;quinazolin-4-amine has a molecular weight of 146.17 g/mol, XLogP of 1.32, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;quinazolin-4-amine is sourced from PubChem (CID 174478214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).