About sodium;1-[6-(2,5-dioxopyrrolidin-1-yl)oxyhexyl]pyrrole-2,5-dione;hydride
sodium;1-[6-(2,5-dioxopyrrolidin-1-yl)oxyhexyl]pyrrole-2,5-dione;hydride (PubChem CID 174478250) has the molecular formula C14H19N2NaO5
and a molecular weight of 318.30 g/mol. Its IUPAC name is sodium;1-[6-(2,5-dioxopyrrolidin-1-yl)oxyhexyl]pyrrole-2,5-dione;hydride.
Molecular Properties
| Compound Name | sodium;1-[6-(2,5-dioxopyrrolidin-1-yl)oxyhexyl]pyrrole-2,5-dione;hydride |
| PubChem CID | 174478250 |
| Molecular Formula | C14H19N2NaO5 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | sodium;1-[6-(2,5-dioxopyrrolidin-1-yl)oxyhexyl]pyrrole-2,5-dione;hydride |
| SMILES | O=C1C=CC(=O)N1CCCCCCON1C(=O)CCC1=O.[H-].[Na+] |
| InChI | InChI=1S/C14H18N2O5.Na.H/c17-11-5-6-12(18)15(11)9-3-1-2-4-10-21-16-13(19)7-8-14(16)20;;/h5-6H,1-4,7-10H2;;/q;+1;-1 |
| InChIKey | ASQAAKPAIXTQRG-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze sodium;1-[6-(2,5-dioxopyrrolidin-1-yl)oxyhexyl]pyrrole-2,5-dione;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-[6-(2,5-dioxopyrrolidin-1-yl)oxyhexyl]pyrrole-2,5-dione;hydride?
The IUPAC name of sodium;1-[6-(2,5-dioxopyrrolidin-1-yl)oxyhexyl]pyrrole-2,5-dione;hydride (CID 174478250) is sodium;1-[6-(2,5-dioxopyrrolidin-1-yl)oxyhexyl]pyrrole-2,5-dione;hydride.
What is the SMILES notation for sodium;1-[6-(2,5-dioxopyrrolidin-1-yl)oxyhexyl]pyrrole-2,5-dione;hydride?
The canonical SMILES for sodium;1-[6-(2,5-dioxopyrrolidin-1-yl)oxyhexyl]pyrrole-2,5-dione;hydride is O=C1C=CC(=O)N1CCCCCCON1C(=O)CCC1=O.[H-].[Na+].
What is the InChIKey of sodium;1-[6-(2,5-dioxopyrrolidin-1-yl)oxyhexyl]pyrrole-2,5-dione;hydride?
The InChIKey is ASQAAKPAIXTQRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O5.Na.H/c17-11-5-6-12(18)15(11)9-3-1-2-4-10-21-16-13(19)7-8-14(16)20;;/h5-6H,1-4,7-10H2;;/q;+1;-1.
What are the key properties of sodium;1-[6-(2,5-dioxopyrrolidin-1-yl)oxyhexyl]pyrrole-2,5-dione;hydride?
sodium;1-[6-(2,5-dioxopyrrolidin-1-yl)oxyhexyl]pyrrole-2,5-dione;hydride has a molecular weight of 318.30 g/mol, XLogP of -2.33, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-[6-(2,5-dioxopyrrolidin-1-yl)oxyhexyl]pyrrole-2,5-dione;hydride is sourced from PubChem (CID 174478250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).