C11H20O3 — CID 174479071
ethyl 4,6-dimethyl-3-oxoheptanoate (PubChem CID 174479071) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is ethyl 4,6-dimethyl-3-oxoheptanoate.
| Compound Name | ethyl 4,6-dimethyl-3-oxoheptanoate |
|---|---|
| PubChem CID | 174479071 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | ethyl 4,6-dimethyl-3-oxoheptanoate |
| SMILES | CCOC(=O)CC(=O)C(C)CC(C)C |
| InChI | InChI=1S/C11H20O3/c1-5-14-11(13)7-10(12)9(4)6-8(2)3/h8-9H,5-7H2,1-4H3 |
| InChIKey | LEMXYHUQWSBNOD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|