About bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;4-(trifluoromethyl)pyrimidine
bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;4-(trifluoromethyl)pyrimidine (PubChem CID 174479107) has the molecular formula C11H7F3N2O
and a molecular weight of 240.18 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;4-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;4-(trifluoromethyl)pyrimidine |
| PubChem CID | 174479107 |
| Molecular Formula | C11H7F3N2O |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;4-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1ccncn1.Oc1cc2ccc1-2 |
| InChI | InChI=1S/C6H4O.C5H3F3N2/c7-6-3-4-1-2-5(4)6;6-5(7,8)4-1-2-9-3-10-4/h1-3,7H;1-3H |
| InChIKey | JZJYCGFUZGWFDN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;4-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;4-(trifluoromethyl)pyrimidine?
The IUPAC name of bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;4-(trifluoromethyl)pyrimidine (CID 174479107) is bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;4-(trifluoromethyl)pyrimidine.
What is the SMILES notation for bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;4-(trifluoromethyl)pyrimidine?
The canonical SMILES for bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;4-(trifluoromethyl)pyrimidine is FC(F)(F)c1ccncn1.Oc1cc2ccc1-2.
What is the InChIKey of bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;4-(trifluoromethyl)pyrimidine?
The InChIKey is JZJYCGFUZGWFDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O.C5H3F3N2/c7-6-3-4-1-2-5(4)6;6-5(7,8)4-1-2-9-3-10-4/h1-3,7H;1-3H.
What are the key properties of bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;4-(trifluoromethyl)pyrimidine?
bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;4-(trifluoromethyl)pyrimidine has a molecular weight of 240.18 g/mol, XLogP of 2.87, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.0]hexa-1,3,5-trien-2-ol;4-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 174479107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).