About 1-[4-(3-methyl-2H-1,3-benzothiazol-2-yl)phenyl]ethanone;hydrobromide
1-[4-(3-methyl-2H-1,3-benzothiazol-2-yl)phenyl]ethanone;hydrobromide (PubChem CID 174480270) has the molecular formula C16H16BrNOS
and a molecular weight of 350.28 g/mol. Its IUPAC name is 1-[4-(3-methyl-2H-1,3-benzothiazol-2-yl)phenyl]ethanone;hydrobromide.
Molecular Properties
| Compound Name | 1-[4-(3-methyl-2H-1,3-benzothiazol-2-yl)phenyl]ethanone;hydrobromide |
| PubChem CID | 174480270 |
| Molecular Formula | C16H16BrNOS |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 1-[4-(3-methyl-2H-1,3-benzothiazol-2-yl)phenyl]ethanone;hydrobromide |
| SMILES | Br.CC(=O)c1ccc(C2Sc3ccccc3N2C)cc1 |
| InChI | InChI=1S/C16H15NOS.BrH/c1-11(18)12-7-9-13(10-8-12)16-17(2)14-5-3-4-6-15(14)19-16;/h3-10,16H,1-2H3;1H |
| InChIKey | XXBHDFCRVAWBHX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(3-methyl-2H-1,3-benzothiazol-2-yl)phenyl]ethanone;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3-methyl-2H-1,3-benzothiazol-2-yl)phenyl]ethanone;hydrobromide?
The IUPAC name of 1-[4-(3-methyl-2H-1,3-benzothiazol-2-yl)phenyl]ethanone;hydrobromide (CID 174480270) is 1-[4-(3-methyl-2H-1,3-benzothiazol-2-yl)phenyl]ethanone;hydrobromide.
What is the SMILES notation for 1-[4-(3-methyl-2H-1,3-benzothiazol-2-yl)phenyl]ethanone;hydrobromide?
The canonical SMILES for 1-[4-(3-methyl-2H-1,3-benzothiazol-2-yl)phenyl]ethanone;hydrobromide is Br.CC(=O)c1ccc(C2Sc3ccccc3N2C)cc1.
What is the InChIKey of 1-[4-(3-methyl-2H-1,3-benzothiazol-2-yl)phenyl]ethanone;hydrobromide?
The InChIKey is XXBHDFCRVAWBHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NOS.BrH/c1-11(18)12-7-9-13(10-8-12)16-17(2)14-5-3-4-6-15(14)19-16;/h3-10,16H,1-2H3;1H.
What are the key properties of 1-[4-(3-methyl-2H-1,3-benzothiazol-2-yl)phenyl]ethanone;hydrobromide?
1-[4-(3-methyl-2H-1,3-benzothiazol-2-yl)phenyl]ethanone;hydrobromide has a molecular weight of 350.28 g/mol, XLogP of 4.71, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3-methyl-2H-1,3-benzothiazol-2-yl)phenyl]ethanone;hydrobromide is sourced from PubChem (CID 174480270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).