About 4-(azetidin-1-yl)-N,N,2-trimethylbutanamide
4-(azetidin-1-yl)-N,N,2-trimethylbutanamide (PubChem CID 174480580) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 4-(azetidin-1-yl)-N,N,2-trimethylbutanamide.
Molecular Properties
| Compound Name | 4-(azetidin-1-yl)-N,N,2-trimethylbutanamide |
| PubChem CID | 174480580 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 4-(azetidin-1-yl)-N,N,2-trimethylbutanamide |
| SMILES | CC(CCN1CCC1)C(=O)N(C)C |
| InChI | InChI=1S/C10H20N2O/c1-9(10(13)11(2)3)5-8-12-6-4-7-12/h9H,4-8H2,1-3H3 |
| InChIKey | KQZLCLSNACGALL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(azetidin-1-yl)-N,N,2-trimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azetidin-1-yl)-N,N,2-trimethylbutanamide?
The IUPAC name of 4-(azetidin-1-yl)-N,N,2-trimethylbutanamide (CID 174480580) is 4-(azetidin-1-yl)-N,N,2-trimethylbutanamide.
What is the SMILES notation for 4-(azetidin-1-yl)-N,N,2-trimethylbutanamide?
The canonical SMILES for 4-(azetidin-1-yl)-N,N,2-trimethylbutanamide is CC(CCN1CCC1)C(=O)N(C)C.
What is the InChIKey of 4-(azetidin-1-yl)-N,N,2-trimethylbutanamide?
The InChIKey is KQZLCLSNACGALL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-9(10(13)11(2)3)5-8-12-6-4-7-12/h9H,4-8H2,1-3H3.
What are the key properties of 4-(azetidin-1-yl)-N,N,2-trimethylbutanamide?
4-(azetidin-1-yl)-N,N,2-trimethylbutanamide has a molecular weight of 184.28 g/mol, XLogP of 0.81, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azetidin-1-yl)-N,N,2-trimethylbutanamide is sourced from PubChem (CID 174480580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).