C18H15BrO — CID 174480814
6-bromo-1,2,3,4-tetrahydrochrysen-4-ol (PubChem CID 174480814) has the molecular formula C18H15BrO and a molecular weight of 327.22 g/mol. Its IUPAC name is 6-bromo-1,2,3,4-tetrahydrochrysen-4-ol.
| Compound Name | 6-bromo-1,2,3,4-tetrahydrochrysen-4-ol |
|---|---|
| PubChem CID | 174480814 |
| Molecular Formula | C18H15BrO |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 6-bromo-1,2,3,4-tetrahydrochrysen-4-ol |
| SMILES | OC1CCCc2ccc3c(cc(Br)c4ccccc43)c21 |
| InChI | InChI=1S/C18H15BrO/c19-16-10-15-13(12-5-1-2-6-14(12)16)9-8-11-4-3-7-17(20)18(11)15/h1-2,5-6,8-10,17,20H,3-4,7H2 |
| InChIKey | HFGASXJMCXXWPL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|