C48H40N4O7 — CID 174480900
1-[3-(aminomethyl)phenyl]-3,4-dihydro-1H-chrysen-2-one;4-(4-cyanophenyl)-6-methylbenzene-1,3-dicarboxylic acid;ethyl pyrimidine-5-carboxylate (PubChem CID 174480900) has the molecular formula C48H40N4O7 and a molecular weight of 784.87 g/mol. Its IUPAC name is 1-[3-(aminomethyl)phenyl]-3,4-dihydro-1H-chrysen-2-one;4-(4-cyanophenyl)-6-methylbenzene-1,3-dicarboxylic acid;ethyl pyrimidine-5-carboxylate.
| Compound Name | 1-[3-(aminomethyl)phenyl]-3,4-dihydro-1H-chrysen-2-one;4-(4-cyanophenyl)-6-methylbenzene-1,3-dicarboxylic acid;ethyl pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 174480900 |
| Molecular Formula | C48H40N4O7 |
| Molecular Weight | 784.87 g/mol |
| Exact Mass | 784.29 |
| IUPAC Name | 1-[3-(aminomethyl)phenyl]-3,4-dihydro-1H-chrysen-2-one;4-(4-cyanophenyl)-6-methylbenzene-1,3-dicarboxylic acid;ethyl pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cncnc1.Cc1cc(-c2ccc(C#N)cc2)c(C(=O)O)cc1C(=O)O.NCc1cccc(C2C(=O)CCc3c2ccc2c3ccc3ccccc32)c1 |
| InChI | InChI=1S/C25H21NO.C16H11NO4.C7H8N2O2/c26-15-16-4-3-6-18(14-16)25-23-11-10-20-19-7-2-1-5-17(19)8-9-21(20)22(23)12-13-24(25)27;1-9-6-13(11-4-2-10(8-17)3-5-11)14(16(20)21)7-12(9)15(18)19;1-2-11-7(10)6-3-8-5-9-4-6/h1-11,14,25H,12-13,15,26H2;2-7H,1H3,(H,18,19)(H,20,21);3-5H,2H2,1H3 |
| InChIKey | CTROAVIBGBZKEL-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 193.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.87 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|