C41H32F3N3O3 — CID 174480920
4-[3,6-dimethyl-2-oxo-1-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-chrysen-4-yl]benzonitrile;ethyl pyrimidine-5-carboxylate (PubChem CID 174480920) has the molecular formula C41H32F3N3O3 and a molecular weight of 671.72 g/mol. Its IUPAC name is 4-[3,6-dimethyl-2-oxo-1-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-chrysen-4-yl]benzonitrile;ethyl pyrimidine-5-carboxylate.
| Compound Name | 4-[3,6-dimethyl-2-oxo-1-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-chrysen-4-yl]benzonitrile;ethyl pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 174480920 |
| Molecular Formula | C41H32F3N3O3 |
| Molecular Weight | 671.72 g/mol |
| Exact Mass | 671.24 |
| IUPAC Name | 4-[3,6-dimethyl-2-oxo-1-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-chrysen-4-yl]benzonitrile;ethyl pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cncnc1.Cc1cc2c3c(ccc2c2ccccc12)C(c1cccc(C(F)(F)F)c1)C(=O)C(C)C3c1ccc(C#N)cc1 |
| InChI | InChI=1S/C34H24F3NO.C7H8N2O2/c1-19-16-29-27(26-9-4-3-8-25(19)26)14-15-28-31(23-6-5-7-24(17-23)34(35,36)37)33(39)20(2)30(32(28)29)22-12-10-21(18-38)11-13-22;1-2-11-7(10)6-3-8-5-9-4-6/h3-17,20,30-31H,1-2H3;3-5H,2H2,1H3 |
| InChIKey | ZEEKBTAUKICKTA-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 92.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.72 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|