About 1-ethenyl-3,5-difluoro-2-methyl-4-[(2-methylpropan-2-yl)oxy]benzene
1-ethenyl-3,5-difluoro-2-methyl-4-[(2-methylpropan-2-yl)oxy]benzene (PubChem CID 174481026) has the molecular formula C13H16F2O
and a molecular weight of 226.27 g/mol. Its IUPAC name is 1-ethenyl-3,5-difluoro-2-methyl-4-[(2-methylpropan-2-yl)oxy]benzene.
Molecular Properties
| Compound Name | 1-ethenyl-3,5-difluoro-2-methyl-4-[(2-methylpropan-2-yl)oxy]benzene |
| PubChem CID | 174481026 |
| Molecular Formula | C13H16F2O |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-ethenyl-3,5-difluoro-2-methyl-4-[(2-methylpropan-2-yl)oxy]benzene |
| SMILES | C=Cc1cc(F)c(OC(C)(C)C)c(F)c1C |
| InChI | InChI=1S/C13H16F2O/c1-6-9-7-10(14)12(11(15)8(9)2)16-13(3,4)5/h6-7H,1H2,2-5H3 |
| InChIKey | ZOLJPTPYKFJJFJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethenyl-3,5-difluoro-2-methyl-4-[(2-methylpropan-2-yl)oxy]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-3,5-difluoro-2-methyl-4-[(2-methylpropan-2-yl)oxy]benzene?
The IUPAC name of 1-ethenyl-3,5-difluoro-2-methyl-4-[(2-methylpropan-2-yl)oxy]benzene (CID 174481026) is 1-ethenyl-3,5-difluoro-2-methyl-4-[(2-methylpropan-2-yl)oxy]benzene.
What is the SMILES notation for 1-ethenyl-3,5-difluoro-2-methyl-4-[(2-methylpropan-2-yl)oxy]benzene?
The canonical SMILES for 1-ethenyl-3,5-difluoro-2-methyl-4-[(2-methylpropan-2-yl)oxy]benzene is C=Cc1cc(F)c(OC(C)(C)C)c(F)c1C.
What is the InChIKey of 1-ethenyl-3,5-difluoro-2-methyl-4-[(2-methylpropan-2-yl)oxy]benzene?
The InChIKey is ZOLJPTPYKFJJFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F2O/c1-6-9-7-10(14)12(11(15)8(9)2)16-13(3,4)5/h6-7H,1H2,2-5H3.
What are the key properties of 1-ethenyl-3,5-difluoro-2-methyl-4-[(2-methylpropan-2-yl)oxy]benzene?
1-ethenyl-3,5-difluoro-2-methyl-4-[(2-methylpropan-2-yl)oxy]benzene has a molecular weight of 226.27 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-3,5-difluoro-2-methyl-4-[(2-methylpropan-2-yl)oxy]benzene is sourced from PubChem (CID 174481026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).