About (1-methylcyclohexyl) N-(2-chloro-1,3-thiazol-5-yl)carbamate
(1-methylcyclohexyl) N-(2-chloro-1,3-thiazol-5-yl)carbamate (PubChem CID 174481198) has the molecular formula C11H15ClN2O2S
and a molecular weight of 274.77 g/mol. Its IUPAC name is (1-methylcyclohexyl) N-(2-chloro-1,3-thiazol-5-yl)carbamate.
Molecular Properties
| Compound Name | (1-methylcyclohexyl) N-(2-chloro-1,3-thiazol-5-yl)carbamate |
| PubChem CID | 174481198 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | (1-methylcyclohexyl) N-(2-chloro-1,3-thiazol-5-yl)carbamate |
| SMILES | CC1(OC(=O)Nc2cnc(Cl)s2)CCCCC1 |
| InChI | InChI=1S/C11H15ClN2O2S/c1-11(5-3-2-4-6-11)16-10(15)14-8-7-13-9(12)17-8/h7H,2-6H2,1H3,(H,14,15) |
| InChIKey | CGUVPKNFAYQJAH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methylcyclohexyl) N-(2-chloro-1,3-thiazol-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclohexyl) N-(2-chloro-1,3-thiazol-5-yl)carbamate?
The IUPAC name of (1-methylcyclohexyl) N-(2-chloro-1,3-thiazol-5-yl)carbamate (CID 174481198) is (1-methylcyclohexyl) N-(2-chloro-1,3-thiazol-5-yl)carbamate.
What is the SMILES notation for (1-methylcyclohexyl) N-(2-chloro-1,3-thiazol-5-yl)carbamate?
The canonical SMILES for (1-methylcyclohexyl) N-(2-chloro-1,3-thiazol-5-yl)carbamate is CC1(OC(=O)Nc2cnc(Cl)s2)CCCCC1.
What is the InChIKey of (1-methylcyclohexyl) N-(2-chloro-1,3-thiazol-5-yl)carbamate?
The InChIKey is CGUVPKNFAYQJAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN2O2S/c1-11(5-3-2-4-6-11)16-10(15)14-8-7-13-9(12)17-8/h7H,2-6H2,1H3,(H,14,15).
What are the key properties of (1-methylcyclohexyl) N-(2-chloro-1,3-thiazol-5-yl)carbamate?
(1-methylcyclohexyl) N-(2-chloro-1,3-thiazol-5-yl)carbamate has a molecular weight of 274.77 g/mol, XLogP of 4.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclohexyl) N-(2-chloro-1,3-thiazol-5-yl)carbamate is sourced from PubChem (CID 174481198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).