C25H23ClN2O5 — CID 174481321
[4-chloro-3-[[4-[[(2S)-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl]amino]phenyl] acetate (PubChem CID 174481321) has the molecular formula C25H23ClN2O5 and a molecular weight of 466.92 g/mol. Its IUPAC name is [4-chloro-3-[[4-[[(2S)-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl]amino]phenyl] acetate.
| Compound Name | [4-chloro-3-[[4-[[(2S)-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 174481321 |
| Molecular Formula | C25H23ClN2O5 |
| Molecular Weight | 466.92 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | [4-chloro-3-[[4-[[(2S)-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl]amino]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(Cl)c(NC(=O)c2ccc(OC[C@@H]3CN(C)c4ccccc4O3)cc2)c1 |
| InChI | InChI=1S/C25H23ClN2O5/c1-16(29)32-19-11-12-21(26)22(13-19)27-25(30)17-7-9-18(10-8-17)31-15-20-14-28(2)23-5-3-4-6-24(23)33-20/h3-13,20H,14-15H2,1-2H3,(H,27,30)/t20-/m0/s1 |
| InChIKey | YAEPUXWNRROIHU-FQEVSTJZSA-N |
| XLogP | 4.79 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.92 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|