About 4-(4-methoxyiminocyclohexa-1,5-dien-1-yl)butan-2-one
4-(4-methoxyiminocyclohexa-1,5-dien-1-yl)butan-2-one (PubChem CID 174483364) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-(4-methoxyiminocyclohexa-1,5-dien-1-yl)butan-2-one.
Molecular Properties
| Compound Name | 4-(4-methoxyiminocyclohexa-1,5-dien-1-yl)butan-2-one |
| PubChem CID | 174483364 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 4-(4-methoxyiminocyclohexa-1,5-dien-1-yl)butan-2-one |
| SMILES | CON=C1C=CC(CCC(C)=O)=CC1 |
| InChI | InChI=1S/C11H15NO2/c1-9(13)3-4-10-5-7-11(8-6-10)12-14-2/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | ZNBIKWRIKKMPIR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methoxyiminocyclohexa-1,5-dien-1-yl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyiminocyclohexa-1,5-dien-1-yl)butan-2-one?
The IUPAC name of 4-(4-methoxyiminocyclohexa-1,5-dien-1-yl)butan-2-one (CID 174483364) is 4-(4-methoxyiminocyclohexa-1,5-dien-1-yl)butan-2-one.
What is the SMILES notation for 4-(4-methoxyiminocyclohexa-1,5-dien-1-yl)butan-2-one?
The canonical SMILES for 4-(4-methoxyiminocyclohexa-1,5-dien-1-yl)butan-2-one is CON=C1C=CC(CCC(C)=O)=CC1.
What is the InChIKey of 4-(4-methoxyiminocyclohexa-1,5-dien-1-yl)butan-2-one?
The InChIKey is ZNBIKWRIKKMPIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-9(13)3-4-10-5-7-11(8-6-10)12-14-2/h5-7H,3-4,8H2,1-2H3.
What are the key properties of 4-(4-methoxyiminocyclohexa-1,5-dien-1-yl)butan-2-one?
4-(4-methoxyiminocyclohexa-1,5-dien-1-yl)butan-2-one has a molecular weight of 193.25 g/mol, XLogP of 2.24, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyiminocyclohexa-1,5-dien-1-yl)butan-2-one is sourced from PubChem (CID 174483364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).