C18H16N3O2S- — CID 174483474
2-[4-(4-cyanophenyl)-7-ethylpyrrolo[1,2-b]pyridazin-2-yl]ethanesulfinate (PubChem CID 174483474) has the molecular formula C18H16N3O2S- and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-[4-(4-cyanophenyl)-7-ethylpyrrolo[1,2-b]pyridazin-2-yl]ethanesulfinate.
| Compound Name | 2-[4-(4-cyanophenyl)-7-ethylpyrrolo[1,2-b]pyridazin-2-yl]ethanesulfinate |
|---|---|
| PubChem CID | 174483474 |
| Molecular Formula | C18H16N3O2S- |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2-[4-(4-cyanophenyl)-7-ethylpyrrolo[1,2-b]pyridazin-2-yl]ethanesulfinate |
| SMILES | CCc1ccc2c(-c3ccc(C#N)cc3)cc(CCS(=O)[O-])nn12 |
| InChI | InChI=1S/C18H17N3O2S/c1-2-16-7-8-18-17(14-5-3-13(12-19)4-6-14)11-15(20-21(16)18)9-10-24(22)23/h3-8,11H,2,9-10H2,1H3,(H,22,23)/p-1 |
| InChIKey | PMXSWKNOCIZVNO-UHFFFAOYSA-M |
| XLogP | 2.86 |
| TPSA | 81.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|