C16H24N2O — CID 174484222
2-[1-(2-methoxyphenyl)ethyl]heptane-1,4-diimine (PubChem CID 174484222) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-[1-(2-methoxyphenyl)ethyl]heptane-1,4-diimine.
| Compound Name | 2-[1-(2-methoxyphenyl)ethyl]heptane-1,4-diimine |
|---|---|
| PubChem CID | 174484222 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 2-[1-(2-methoxyphenyl)ethyl]heptane-1,4-diimine |
| SMILES | [H]/N=C/C(C/C(CCC)=N/[H])C(C)c1ccccc1OC |
| InChI | InChI=1S/C16H24N2O/c1-4-7-14(18)10-13(11-17)12(2)15-8-5-6-9-16(15)19-3/h5-6,8-9,11-13,17-18H,4,7,10H2,1-3H3/b17-11+,18-14+ |
| InChIKey | SSKSFLAUXFNPLP-CBXDKUCNSA-N |
| XLogP | 4.27 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|