C12H23NO4 — CID 174484785
tert-butyl formate;(2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridine (PubChem CID 174484785) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is tert-butyl formate;(2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridine.
| Compound Name | tert-butyl formate;(2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridine |
|---|---|
| PubChem CID | 174484785 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | tert-butyl formate;(2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridine |
| SMILES | CC(C)(C)OC=O.CC1(C)OC[C@H]([C@H]2CN2)O1 |
| InChI | InChI=1S/C7H13NO2.C5H10O2/c1-7(2)9-4-6(10-7)5-3-8-5;1-5(2,3)7-4-6/h5-6,8H,3-4H2,1-2H3;4H,1-3H3/t5-,6-;/m1./s1 |
| InChIKey | DXTZXRMRQXNAFS-KGZKBUQUSA-N |
| XLogP | 1.07 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|