C20H32O6 — CID 174485136
cyclohexane-1,4-dicarboxylic acid;propan-2-yl 2-cyclohexylprop-2-enoate (PubChem CID 174485136) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is cyclohexane-1,4-dicarboxylic acid;propan-2-yl 2-cyclohexylprop-2-enoate.
| Compound Name | cyclohexane-1,4-dicarboxylic acid;propan-2-yl 2-cyclohexylprop-2-enoate |
|---|---|
| PubChem CID | 174485136 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | cyclohexane-1,4-dicarboxylic acid;propan-2-yl 2-cyclohexylprop-2-enoate |
| SMILES | C=C(C(=O)OC(C)C)C1CCCCC1.O=C(O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C12H20O2.C8H12O4/c1-9(2)14-12(13)10(3)11-7-5-4-6-8-11;9-7(10)5-1-2-6(4-3-5)8(11)12/h9,11H,3-8H2,1-2H3;5-6H,1-4H2,(H,9,10)(H,11,12) |
| InChIKey | KEVVOKRNXJYMEQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|