About 2-ethylbutoxyalumane
2-ethylbutoxyalumane (PubChem CID 174485675) has the molecular formula C6H15AlO
and a molecular weight of 130.17 g/mol. Its IUPAC name is 2-ethylbutoxyalumane.
Molecular Properties
| Compound Name | 2-ethylbutoxyalumane |
| PubChem CID | 174485675 |
| Molecular Formula | C6H15AlO |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | 2-ethylbutoxyalumane |
| SMILES | CCC(CC)CO[AlH2] |
| InChI | InChI=1S/C6H13O.Al.2H/c1-3-6(4-2)5-7;;;/h6H,3-5H2,1-2H3;;;/q-1;+1;; |
| InChIKey | JCDJGLYXHZUJDW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethylbutoxyalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylbutoxyalumane?
The IUPAC name of 2-ethylbutoxyalumane (CID 174485675) is 2-ethylbutoxyalumane.
What is the SMILES notation for 2-ethylbutoxyalumane?
The canonical SMILES for 2-ethylbutoxyalumane is CCC(CC)CO[AlH2].
What is the InChIKey of 2-ethylbutoxyalumane?
The InChIKey is JCDJGLYXHZUJDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O.Al.2H/c1-3-6(4-2)5-7;;;/h6H,3-5H2,1-2H3;;;/q-1;+1;;.
What are the key properties of 2-ethylbutoxyalumane?
2-ethylbutoxyalumane has a molecular weight of 130.17 g/mol, XLogP of 0.99, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylbutoxyalumane is sourced from PubChem (CID 174485675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).