About ethyl formate;2-piperidin-4-ylphenol
ethyl formate;2-piperidin-4-ylphenol (PubChem CID 174485729) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is ethyl formate;2-piperidin-4-ylphenol.
Molecular Properties
| Compound Name | ethyl formate;2-piperidin-4-ylphenol |
| PubChem CID | 174485729 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | ethyl formate;2-piperidin-4-ylphenol |
| SMILES | CCOC=O.Oc1ccccc1C1CCNCC1 |
| InChI | InChI=1S/C11H15NO.C3H6O2/c13-11-4-2-1-3-10(11)9-5-7-12-8-6-9;1-2-5-3-4/h1-4,9,12-13H,5-8H2;3H,2H2,1H3 |
| InChIKey | JJKFAJZGCZJIMO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;2-piperidin-4-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;2-piperidin-4-ylphenol?
The IUPAC name of ethyl formate;2-piperidin-4-ylphenol (CID 174485729) is ethyl formate;2-piperidin-4-ylphenol.
What is the SMILES notation for ethyl formate;2-piperidin-4-ylphenol?
The canonical SMILES for ethyl formate;2-piperidin-4-ylphenol is CCOC=O.Oc1ccccc1C1CCNCC1.
What is the InChIKey of ethyl formate;2-piperidin-4-ylphenol?
The InChIKey is JJKFAJZGCZJIMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO.C3H6O2/c13-11-4-2-1-3-10(11)9-5-7-12-8-6-9;1-2-5-3-4/h1-4,9,12-13H,5-8H2;3H,2H2,1H3.
What are the key properties of ethyl formate;2-piperidin-4-ylphenol?
ethyl formate;2-piperidin-4-ylphenol has a molecular weight of 251.33 g/mol, XLogP of 2.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;2-piperidin-4-ylphenol is sourced from PubChem (CID 174485729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).