About 2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl formate
2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl formate (PubChem CID 174485974) has the molecular formula C6H8N2O3
and a molecular weight of 156.14 g/mol. Its IUPAC name is 2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl formate.
Molecular Properties
| Compound Name | 2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl formate |
| PubChem CID | 174485974 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl formate |
| SMILES | O=COCCc1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C6H8N2O3/c9-4-11-2-1-5-3-6(10)8-7-5/h3-4H,1-2H2,(H2,7,8,10) |
| InChIKey | RMGMAWJYGIKBOU-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl formate?
The IUPAC name of 2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl formate (CID 174485974) is 2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl formate.
What is the SMILES notation for 2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl formate?
The canonical SMILES for 2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl formate is O=COCCc1cc(=O)[nH][nH]1.
What is the InChIKey of 2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl formate?
The InChIKey is RMGMAWJYGIKBOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3/c9-4-11-2-1-5-3-6(10)8-7-5/h3-4H,1-2H2,(H2,7,8,10).
What are the key properties of 2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl formate?
2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl formate has a molecular weight of 156.14 g/mol, XLogP of -0.58, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-oxo-1,2-dihydropyrazol-3-yl)ethyl formate is sourced from PubChem (CID 174485974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).