C20H34O2 — CID 174486249
3-cyclohexylpropyl undeca-2,3-dienoate (PubChem CID 174486249) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 3-cyclohexylpropyl undeca-2,3-dienoate.
| Compound Name | 3-cyclohexylpropyl undeca-2,3-dienoate |
|---|---|
| PubChem CID | 174486249 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 3-cyclohexylpropyl undeca-2,3-dienoate |
| SMILES | CCCCCCCC=C=CC(=O)OCCCC1CCCCC1 |
| InChI | InChI=1S/C20H34O2/c1-2-3-4-5-6-7-8-12-17-20(21)22-18-13-16-19-14-10-9-11-15-19/h8,17,19H,2-7,9-11,13-16,18H2,1H3 |
| InChIKey | GNKWCMFOHUAGCD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|