C12H22N4O3 — CID 174486746
1,6-diisocyanatohexane;N,N-dimethylmethanamine;isocyanic acid (PubChem CID 174486746) has the molecular formula C12H22N4O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 1,6-diisocyanatohexane;N,N-dimethylmethanamine;isocyanic acid.
| Compound Name | 1,6-diisocyanatohexane;N,N-dimethylmethanamine;isocyanic acid |
|---|---|
| PubChem CID | 174486746 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 1,6-diisocyanatohexane;N,N-dimethylmethanamine;isocyanic acid |
| SMILES | CN(C)C.N=C=O.O=C=NCCCCCCN=C=O |
| InChI | InChI=1S/C8H12N2O2.C3H9N.CHNO/c11-7-9-5-3-1-2-4-6-10-8-12;1-4(2)3;2-1-3/h1-6H2;1-3H3;2H |
| InChIKey | SSEFZWYJNYHKIX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|