About 5-phenyl-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde
5-phenyl-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde (PubChem CID 174487474) has the molecular formula C9H8N2O2
and a molecular weight of 176.18 g/mol. Its IUPAC name is 5-phenyl-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-phenyl-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde |
| PubChem CID | 174487474 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 5-phenyl-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde |
| SMILES | O=CC1NN=C(c2ccccc2)O1 |
| InChI | InChI=1S/C9H8N2O2/c12-6-8-10-11-9(13-8)7-4-2-1-3-5-7/h1-6,8,10H |
| InChIKey | MTYVUGQFGTYJOC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-phenyl-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde?
The IUPAC name of 5-phenyl-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde (CID 174487474) is 5-phenyl-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde.
What is the SMILES notation for 5-phenyl-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde?
The canonical SMILES for 5-phenyl-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde is O=CC1NN=C(c2ccccc2)O1.
What is the InChIKey of 5-phenyl-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde?
The InChIKey is MTYVUGQFGTYJOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c12-6-8-10-11-9(13-8)7-4-2-1-3-5-7/h1-6,8,10H.
What are the key properties of 5-phenyl-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde?
5-phenyl-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde has a molecular weight of 176.18 g/mol, XLogP of 0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde is sourced from PubChem (CID 174487474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).