C9H7ClN2O2 — CID 174487593
5-(4-chlorophenyl)-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde (PubChem CID 174487593) has the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde.
| Compound Name | 5-(4-chlorophenyl)-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 174487593 |
| Molecular Formula | C9H7ClN2O2 |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 5-(4-chlorophenyl)-2,3-dihydro-1,3,4-oxadiazole-2-carbaldehyde |
| SMILES | O=CC1NN=C(c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C9H7ClN2O2/c10-7-3-1-6(2-4-7)9-12-11-8(5-13)14-9/h1-5,8,11H |
| InChIKey | ZGHUDIGNXCTEIJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|