C29H25NO2 — CID 174487733
naphthalene-2-carboxylic acid;1,2,3,4-tetrahydrochrysen-1-amine (PubChem CID 174487733) has the molecular formula C29H25NO2 and a molecular weight of 419.52 g/mol. Its IUPAC name is naphthalene-2-carboxylic acid;1,2,3,4-tetrahydrochrysen-1-amine.
| Compound Name | naphthalene-2-carboxylic acid;1,2,3,4-tetrahydrochrysen-1-amine |
|---|---|
| PubChem CID | 174487733 |
| Molecular Formula | C29H25NO2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | naphthalene-2-carboxylic acid;1,2,3,4-tetrahydrochrysen-1-amine |
| SMILES | NC1CCCc2c1ccc1c2ccc2ccccc21.O=C(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H17N.C11H8O2/c19-18-7-3-6-14-16-9-8-12-4-1-2-5-13(12)15(16)10-11-17(14)18;12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-2,4-5,8-11,18H,3,6-7,19H2;1-7H,(H,12,13) |
| InChIKey | KKPHIEDSKZCOHN-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|