About 2-butyl-5-methylcyclopenta-1,3-diene;dichlorotitanium
2-butyl-5-methylcyclopenta-1,3-diene;dichlorotitanium (PubChem CID 174487779) has the molecular formula C10H16Cl2Ti
and a molecular weight of 255.01 g/mol. Its IUPAC name is 2-butyl-5-methylcyclopenta-1,3-diene;dichlorotitanium.
Molecular Properties
| Compound Name | 2-butyl-5-methylcyclopenta-1,3-diene;dichlorotitanium |
| PubChem CID | 174487779 |
| Molecular Formula | C10H16Cl2Ti |
| Molecular Weight | 255.01 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 2-butyl-5-methylcyclopenta-1,3-diene;dichlorotitanium |
| SMILES | CCCCC1=CC(C)C=C1.Cl[Ti]Cl |
| InChI | InChI=1S/C10H16.2ClH.Ti/c1-3-4-5-10-7-6-9(2)8-10;;;/h6-9H,3-5H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | RUDHBBBOXUCZMM-UHFFFAOYSA-L |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.01 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-butyl-5-methylcyclopenta-1,3-diene;dichlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-5-methylcyclopenta-1,3-diene;dichlorotitanium?
The IUPAC name of 2-butyl-5-methylcyclopenta-1,3-diene;dichlorotitanium (CID 174487779) is 2-butyl-5-methylcyclopenta-1,3-diene;dichlorotitanium.
What is the SMILES notation for 2-butyl-5-methylcyclopenta-1,3-diene;dichlorotitanium?
The canonical SMILES for 2-butyl-5-methylcyclopenta-1,3-diene;dichlorotitanium is CCCCC1=CC(C)C=C1.Cl[Ti]Cl.
What is the InChIKey of 2-butyl-5-methylcyclopenta-1,3-diene;dichlorotitanium?
The InChIKey is RUDHBBBOXUCZMM-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H16.2ClH.Ti/c1-3-4-5-10-7-6-9(2)8-10;;;/h6-9H,3-5H2,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of 2-butyl-5-methylcyclopenta-1,3-diene;dichlorotitanium?
2-butyl-5-methylcyclopenta-1,3-diene;dichlorotitanium has a molecular weight of 255.01 g/mol, XLogP of 4.69, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-5-methylcyclopenta-1,3-diene;dichlorotitanium is sourced from PubChem (CID 174487779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).