C47H46Cl2F2N8O3 — CID 174487858
1,3-bis[4-[6-amino-5-[(2-chloro-6-fluorophenyl)methoxy]-3-pyridinyl]phenyl]-1,3-bis[(3S)-3-aminopyrrolidin-1-yl]propan-2-one (PubChem CID 174487858) has the molecular formula C47H46Cl2F2N8O3 and a molecular weight of 879.84 g/mol. Its IUPAC name is 1,3-bis[4-[6-amino-5-[(2-chloro-6-fluorophenyl)methoxy]-3-pyridinyl]phenyl]-1,3-bis[(3S)-3-aminopyrrolidin-1-yl]propan-2-one.
| Compound Name | 1,3-bis[4-[6-amino-5-[(2-chloro-6-fluorophenyl)methoxy]-3-pyridinyl]phenyl]-1,3-bis[(3S)-3-aminopyrrolidin-1-yl]propan-2-one |
|---|---|
| PubChem CID | 174487858 |
| Molecular Formula | C47H46Cl2F2N8O3 |
| Molecular Weight | 879.84 g/mol |
| Exact Mass | 878.30 |
| IUPAC Name | 1,3-bis[4-[6-amino-5-[(2-chloro-6-fluorophenyl)methoxy]-3-pyridinyl]phenyl]-1,3-bis[(3S)-3-aminopyrrolidin-1-yl]propan-2-one |
| SMILES | Nc1ncc(-c2ccc(C(C(=O)C(c3ccc(-c4cnc(N)c(OCc5c(F)cccc5Cl)c4)cc3)N3CC[C@H](N)C3)N3CC[C@H](N)C3)cc2)cc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C47H46Cl2F2N8O3/c48-37-3-1-5-39(50)35(37)25-61-41-19-31(21-56-46(41)54)27-7-11-29(12-8-27)43(58-17-15-33(52)23-58)45(60)44(59-18-16-34(53)24-59)30-13-9-28(10-14-30)32-20-42(47(55)57-22-32)62-26-36-38(49)4-2-6-40(36)51/h1-14,19-22,33-34,43-44H,15-18,23-26,52-53H2,(H2,54,56)(H2,55,57)/t33-,34-,43?,44?/m0/s1 |
| InChIKey | QLQFRJKVZNKGSP-QNCOECKJSA-N |
| XLogP | 8.14 |
| TPSA | 171.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.84 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|