C19H19NO4 — CID 17448836
2-(3-acetylphenoxy)-N-(3,4-dihydro-2H-chromen-4-yl)acetamide (PubChem CID 17448836) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 2-(3-acetylphenoxy)-N-(3,4-dihydro-2H-chromen-4-yl)acetamide.
| Compound Name | 2-(3-acetylphenoxy)-N-(3,4-dihydro-2H-chromen-4-yl)acetamide |
|---|---|
| PubChem CID | 17448836 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-(3-acetylphenoxy)-N-(3,4-dihydro-2H-chromen-4-yl)acetamide |
| SMILES | CC(=O)c1cccc(OCC(=O)NC2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C19H19NO4/c1-13(21)14-5-4-6-15(11-14)24-12-19(22)20-17-9-10-23-18-8-3-2-7-16(17)18/h2-8,11,17H,9-10,12H2,1H3,(H,20,22) |
| InChIKey | DYCNAEZKCOKNFQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |