About N'-[2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide
N'-[2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide (PubChem CID 174488668) has the molecular formula C16H19N3O3S2
and a molecular weight of 365.48 g/mol. Its IUPAC name is N'-[2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide.
Molecular Properties
| Compound Name | N'-[2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide |
| PubChem CID | 174488668 |
| Molecular Formula | C16H19N3O3S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N'-[2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide |
| SMILES | CSc1cnc(N(C(=O)C(N)=O)c2ccccc2OCC(C)C)s1 |
| InChI | InChI=1S/C16H19N3O3S2/c1-10(2)9-22-12-7-5-4-6-11(12)19(15(21)14(17)20)16-18-8-13(23-3)24-16/h4-8,10H,9H2,1-3H3,(H2,17,20) |
| InChIKey | RPHDMFCJYSSJBW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide?
The IUPAC name of N'-[2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide (CID 174488668) is N'-[2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide.
What is the SMILES notation for N'-[2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide?
The canonical SMILES for N'-[2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide is CSc1cnc(N(C(=O)C(N)=O)c2ccccc2OCC(C)C)s1.
What is the InChIKey of N'-[2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide?
The InChIKey is RPHDMFCJYSSJBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O3S2/c1-10(2)9-22-12-7-5-4-6-11(12)19(15(21)14(17)20)16-18-8-13(23-3)24-16/h4-8,10H,9H2,1-3H3,(H2,17,20).
What are the key properties of N'-[2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide?
N'-[2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide has a molecular weight of 365.48 g/mol, XLogP of 3.05, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(2-methylpropoxy)phenyl]-N'-(5-methylsulfanyl-1,3-thiazol-2-yl)oxamide is sourced from PubChem (CID 174488668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).