C27H40N2O9 — CID 174488862
4-butyl-6-[(4-butyl-5,6-dioxomorpholin-2-yl)methoxymethyl]morpholine-2,3-dione;1-phenylpropane-1,1-diol (PubChem CID 174488862) has the molecular formula C27H40N2O9 and a molecular weight of 536.62 g/mol. Its IUPAC name is 4-butyl-6-[(4-butyl-5,6-dioxomorpholin-2-yl)methoxymethyl]morpholine-2,3-dione;1-phenylpropane-1,1-diol.
| Compound Name | 4-butyl-6-[(4-butyl-5,6-dioxomorpholin-2-yl)methoxymethyl]morpholine-2,3-dione;1-phenylpropane-1,1-diol |
|---|---|
| PubChem CID | 174488862 |
| Molecular Formula | C27H40N2O9 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 4-butyl-6-[(4-butyl-5,6-dioxomorpholin-2-yl)methoxymethyl]morpholine-2,3-dione;1-phenylpropane-1,1-diol |
| SMILES | CCC(O)(O)c1ccccc1.CCCCN1CC(COCC2CN(CCCC)C(=O)C(=O)O2)OC(=O)C1=O |
| InChI | InChI=1S/C18H28N2O7.C9H12O2/c1-3-5-7-19-9-13(26-17(23)15(19)21)11-25-12-14-10-20(8-6-4-2)16(22)18(24)27-14;1-2-9(10,11)8-6-4-3-5-7-8/h13-14H,3-12H2,1-2H3;3-7,10-11H,2H2,1H3 |
| InChIKey | RTGLWWBWPFHPRJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|