C21H21N3O8S — CID 174489068
2-[3-[(1-methylpyrazol-3-yl)carbamoyl]-5-(4-methylsulfonyloxyphenoxy)phenoxy]propanoic acid (PubChem CID 174489068) has the molecular formula C21H21N3O8S and a molecular weight of 475.48 g/mol. Its IUPAC name is 2-[3-[(1-methylpyrazol-3-yl)carbamoyl]-5-(4-methylsulfonyloxyphenoxy)phenoxy]propanoic acid.
| Compound Name | 2-[3-[(1-methylpyrazol-3-yl)carbamoyl]-5-(4-methylsulfonyloxyphenoxy)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 174489068 |
| Molecular Formula | C21H21N3O8S |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 2-[3-[(1-methylpyrazol-3-yl)carbamoyl]-5-(4-methylsulfonyloxyphenoxy)phenoxy]propanoic acid |
| SMILES | CC(Oc1cc(Oc2ccc(OS(C)(=O)=O)cc2)cc(C(=O)Nc2ccn(C)n2)c1)C(=O)O |
| InChI | InChI=1S/C21H21N3O8S/c1-13(21(26)27)30-17-10-14(20(25)22-19-8-9-24(2)23-19)11-18(12-17)31-15-4-6-16(7-5-15)32-33(3,28)29/h4-13H,1-3H3,(H,26,27)(H,22,23,25) |
| InChIKey | DLZQGBOWONPNIN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|