About 2,3-dihydro-1,4-benzodioxin-6-amine;2-nitropyrimidin-4-amine
2,3-dihydro-1,4-benzodioxin-6-amine;2-nitropyrimidin-4-amine (PubChem CID 174489221) has the molecular formula C12H13N5O4
and a molecular weight of 291.27 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-amine;2-nitropyrimidin-4-amine.
Molecular Properties
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-amine;2-nitropyrimidin-4-amine |
| PubChem CID | 174489221 |
| Molecular Formula | C12H13N5O4 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-amine;2-nitropyrimidin-4-amine |
| SMILES | Nc1ccc2c(c1)OCCO2.Nc1ccnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C8H9NO2.C4H4N4O2/c9-6-1-2-7-8(5-6)11-4-3-10-7;5-3-1-2-6-4(7-3)8(9)10/h1-2,5H,3-4,9H2;1-2H,(H2,5,6,7) |
| InChIKey | CYABXDACBBZYEM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 139.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1,4-benzodioxin-6-amine;2-nitropyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,4-benzodioxin-6-amine;2-nitropyrimidin-4-amine?
The IUPAC name of 2,3-dihydro-1,4-benzodioxin-6-amine;2-nitropyrimidin-4-amine (CID 174489221) is 2,3-dihydro-1,4-benzodioxin-6-amine;2-nitropyrimidin-4-amine.
What is the SMILES notation for 2,3-dihydro-1,4-benzodioxin-6-amine;2-nitropyrimidin-4-amine?
The canonical SMILES for 2,3-dihydro-1,4-benzodioxin-6-amine;2-nitropyrimidin-4-amine is Nc1ccc2c(c1)OCCO2.Nc1ccnc([N+](=O)[O-])n1.
What is the InChIKey of 2,3-dihydro-1,4-benzodioxin-6-amine;2-nitropyrimidin-4-amine?
The InChIKey is CYABXDACBBZYEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C4H4N4O2/c9-6-1-2-7-8(5-6)11-4-3-10-7;5-3-1-2-6-4(7-3)8(9)10/h1-2,5H,3-4,9H2;1-2H,(H2,5,6,7).
What are the key properties of 2,3-dihydro-1,4-benzodioxin-6-amine;2-nitropyrimidin-4-amine?
2,3-dihydro-1,4-benzodioxin-6-amine;2-nitropyrimidin-4-amine has a molecular weight of 291.27 g/mol, XLogP of 1.01, 1 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,4-benzodioxin-6-amine;2-nitropyrimidin-4-amine is sourced from PubChem (CID 174489221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).