C25H27NO3 — CID 174490726
3-(4-amino-2,3-dibenzylphenyl)-2-ethoxypropanoic acid (PubChem CID 174490726) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is 3-(4-amino-2,3-dibenzylphenyl)-2-ethoxypropanoic acid.
| Compound Name | 3-(4-amino-2,3-dibenzylphenyl)-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 174490726 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 3-(4-amino-2,3-dibenzylphenyl)-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(N)c(Cc2ccccc2)c1Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H27NO3/c1-2-29-24(25(27)28)17-20-13-14-23(26)22(16-19-11-7-4-8-12-19)21(20)15-18-9-5-3-6-10-18/h3-14,24H,2,15-17,26H2,1H3,(H,27,28) |
| InChIKey | IGKHJJURBFCFRO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|