About [2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-4-yl] acetate
[2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-4-yl] acetate (PubChem CID 174491320) has the molecular formula C11H10FNO2S
and a molecular weight of 239.27 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-4-yl] acetate.
Molecular Properties
| Compound Name | [2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-4-yl] acetate |
| PubChem CID | 174491320 |
| Molecular Formula | C11H10FNO2S |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | [2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-4-yl] acetate |
| SMILES | CC(=O)OC1CSC(c2ccc(F)cc2)=N1 |
| InChI | InChI=1S/C11H10FNO2S/c1-7(14)15-10-6-16-11(13-10)8-2-4-9(12)5-3-8/h2-5,10H,6H2,1H3 |
| InChIKey | NVSSQHJSWCFFQU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-4-yl] acetate?
The IUPAC name of [2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-4-yl] acetate (CID 174491320) is [2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-4-yl] acetate.
What is the SMILES notation for [2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-4-yl] acetate?
The canonical SMILES for [2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-4-yl] acetate is CC(=O)OC1CSC(c2ccc(F)cc2)=N1.
What is the InChIKey of [2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-4-yl] acetate?
The InChIKey is NVSSQHJSWCFFQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNO2S/c1-7(14)15-10-6-16-11(13-10)8-2-4-9(12)5-3-8/h2-5,10H,6H2,1H3.
What are the key properties of [2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-4-yl] acetate?
[2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-4-yl] acetate has a molecular weight of 239.27 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-4-yl] acetate is sourced from PubChem (CID 174491320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).