C21H24N4O4 — CID 174492618
[3-(4-amino-3,5-dimethylphenyl)-2,4-dioxo-1H-quinazolin-7-yl] N-tert-butylcarbamate (PubChem CID 174492618) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is [3-(4-amino-3,5-dimethylphenyl)-2,4-dioxo-1H-quinazolin-7-yl] N-tert-butylcarbamate.
| Compound Name | [3-(4-amino-3,5-dimethylphenyl)-2,4-dioxo-1H-quinazolin-7-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174492618 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | [3-(4-amino-3,5-dimethylphenyl)-2,4-dioxo-1H-quinazolin-7-yl] N-tert-butylcarbamate |
| SMILES | Cc1cc(-n2c(=O)[nH]c3cc(OC(=O)NC(C)(C)C)ccc3c2=O)cc(C)c1N |
| InChI | InChI=1S/C21H24N4O4/c1-11-8-13(9-12(2)17(11)22)25-18(26)15-7-6-14(10-16(15)23-19(25)27)29-20(28)24-21(3,4)5/h6-10H,22H2,1-5H3,(H,23,27)(H,24,28) |
| InChIKey | XKDPSHIJIXJKOA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|