About 4-(4-amino-2,3,6-trifluorophenyl)phenol
4-(4-amino-2,3,6-trifluorophenyl)phenol (PubChem CID 174494106) has the molecular formula C12H8F3NO
and a molecular weight of 239.20 g/mol. Its IUPAC name is 4-(4-amino-2,3,6-trifluorophenyl)phenol.
Molecular Properties
| Compound Name | 4-(4-amino-2,3,6-trifluorophenyl)phenol |
| PubChem CID | 174494106 |
| Molecular Formula | C12H8F3NO |
| Molecular Weight | 239.20 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 4-(4-amino-2,3,6-trifluorophenyl)phenol |
| SMILES | Nc1cc(F)c(-c2ccc(O)cc2)c(F)c1F |
| InChI | InChI=1S/C12H8F3NO/c13-8-5-9(16)11(14)12(15)10(8)6-1-3-7(17)4-2-6/h1-5,17H,16H2 |
| InChIKey | ZXSWKKUFNUXLGY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.20 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-amino-2,3,6-trifluorophenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-2,3,6-trifluorophenyl)phenol?
The IUPAC name of 4-(4-amino-2,3,6-trifluorophenyl)phenol (CID 174494106) is 4-(4-amino-2,3,6-trifluorophenyl)phenol.
What is the SMILES notation for 4-(4-amino-2,3,6-trifluorophenyl)phenol?
The canonical SMILES for 4-(4-amino-2,3,6-trifluorophenyl)phenol is Nc1cc(F)c(-c2ccc(O)cc2)c(F)c1F.
What is the InChIKey of 4-(4-amino-2,3,6-trifluorophenyl)phenol?
The InChIKey is ZXSWKKUFNUXLGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F3NO/c13-8-5-9(16)11(14)12(15)10(8)6-1-3-7(17)4-2-6/h1-5,17H,16H2.
What are the key properties of 4-(4-amino-2,3,6-trifluorophenyl)phenol?
4-(4-amino-2,3,6-trifluorophenyl)phenol has a molecular weight of 239.20 g/mol, XLogP of 3.06, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-2,3,6-trifluorophenyl)phenol is sourced from PubChem (CID 174494106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).