About 1-O-[[benzoyl(methyl)amino]methyl] 3-O-tert-butyl 2-(aminomethyl)-2-ethylpropanedioate
1-O-[[benzoyl(methyl)amino]methyl] 3-O-tert-butyl 2-(aminomethyl)-2-ethylpropanedioate (PubChem CID 174494175) has the molecular formula C19H28N2O5
and a molecular weight of 364.44 g/mol. Its IUPAC name is 1-O-[[benzoyl(methyl)amino]methyl] 3-O-tert-butyl 2-(aminomethyl)-2-ethylpropanedioate.
Molecular Properties
| Compound Name | 1-O-[[benzoyl(methyl)amino]methyl] 3-O-tert-butyl 2-(aminomethyl)-2-ethylpropanedioate |
| PubChem CID | 174494175 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-O-[[benzoyl(methyl)amino]methyl] 3-O-tert-butyl 2-(aminomethyl)-2-ethylpropanedioate |
| SMILES | CCC(CN)(C(=O)OCN(C)C(=O)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28N2O5/c1-6-19(12-20,17(24)26-18(2,3)4)16(23)25-13-21(5)15(22)14-10-8-7-9-11-14/h7-11H,6,12-13,20H2,1-5H3 |
| InChIKey | JBOUZEVYOZNUTC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[[benzoyl(methyl)amino]methyl] 3-O-tert-butyl 2-(aminomethyl)-2-ethylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[[benzoyl(methyl)amino]methyl] 3-O-tert-butyl 2-(aminomethyl)-2-ethylpropanedioate?
The IUPAC name of 1-O-[[benzoyl(methyl)amino]methyl] 3-O-tert-butyl 2-(aminomethyl)-2-ethylpropanedioate (CID 174494175) is 1-O-[[benzoyl(methyl)amino]methyl] 3-O-tert-butyl 2-(aminomethyl)-2-ethylpropanedioate.
What is the SMILES notation for 1-O-[[benzoyl(methyl)amino]methyl] 3-O-tert-butyl 2-(aminomethyl)-2-ethylpropanedioate?
The canonical SMILES for 1-O-[[benzoyl(methyl)amino]methyl] 3-O-tert-butyl 2-(aminomethyl)-2-ethylpropanedioate is CCC(CN)(C(=O)OCN(C)C(=O)c1ccccc1)C(=O)OC(C)(C)C.
What is the InChIKey of 1-O-[[benzoyl(methyl)amino]methyl] 3-O-tert-butyl 2-(aminomethyl)-2-ethylpropanedioate?
The InChIKey is JBOUZEVYOZNUTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2O5/c1-6-19(12-20,17(24)26-18(2,3)4)16(23)25-13-21(5)15(22)14-10-8-7-9-11-14/h7-11H,6,12-13,20H2,1-5H3.
What are the key properties of 1-O-[[benzoyl(methyl)amino]methyl] 3-O-tert-butyl 2-(aminomethyl)-2-ethylpropanedioate?
1-O-[[benzoyl(methyl)amino]methyl] 3-O-tert-butyl 2-(aminomethyl)-2-ethylpropanedioate has a molecular weight of 364.44 g/mol, XLogP of 1.96, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[[benzoyl(methyl)amino]methyl] 3-O-tert-butyl 2-(aminomethyl)-2-ethylpropanedioate is sourced from PubChem (CID 174494175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).