About 1,1'-biphenyl;2-phosphanylbenzene-1,4-diol
1,1'-biphenyl;2-phosphanylbenzene-1,4-diol (PubChem CID 174494333) has the molecular formula C18H17O2P
and a molecular weight of 296.31 g/mol. Its IUPAC name is 1,1'-biphenyl;2-phosphanylbenzene-1,4-diol.
Molecular Properties
| Compound Name | 1,1'-biphenyl;2-phosphanylbenzene-1,4-diol |
| PubChem CID | 174494333 |
| Molecular Formula | C18H17O2P |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1,1'-biphenyl;2-phosphanylbenzene-1,4-diol |
| SMILES | Oc1ccc(O)c(P)c1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C6H7O2P/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;7-4-1-2-5(8)6(9)3-4/h1-10H;1-3,7-8H,9H2 |
| InChIKey | HAFTUBWAJPNORR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;2-phosphanylbenzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;2-phosphanylbenzene-1,4-diol?
The IUPAC name of 1,1'-biphenyl;2-phosphanylbenzene-1,4-diol (CID 174494333) is 1,1'-biphenyl;2-phosphanylbenzene-1,4-diol.
What is the SMILES notation for 1,1'-biphenyl;2-phosphanylbenzene-1,4-diol?
The canonical SMILES for 1,1'-biphenyl;2-phosphanylbenzene-1,4-diol is Oc1ccc(O)c(P)c1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;2-phosphanylbenzene-1,4-diol?
The InChIKey is HAFTUBWAJPNORR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C6H7O2P/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;7-4-1-2-5(8)6(9)3-4/h1-10H;1-3,7-8H,9H2.
What are the key properties of 1,1'-biphenyl;2-phosphanylbenzene-1,4-diol?
1,1'-biphenyl;2-phosphanylbenzene-1,4-diol has a molecular weight of 296.31 g/mol, XLogP of 3.95, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;2-phosphanylbenzene-1,4-diol is sourced from PubChem (CID 174494333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).