C15H22N4O2S2 — CID 17449434
2-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione (PubChem CID 17449434) has the molecular formula C15H22N4O2S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is 2-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione.
| Compound Name | 2-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
|---|---|
| PubChem CID | 17449434 |
| Molecular Formula | C15H22N4O2S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
| SMILES | CC(C)CN(Cn1nc2ccccn2c1=S)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H22N4O2S2/c1-12(2)9-17(13-6-8-23(20,21)10-13)11-19-15(22)18-7-4-3-5-14(18)16-19/h3-5,7,12-13H,6,8-11H2,1-2H3 |
| InChIKey | STVPQGKIOFAHJI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 59.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|