About silane;triethoxy(phenyl)silane;hydrofluoride
silane;triethoxy(phenyl)silane;hydrofluoride (PubChem CID 174494492) has the molecular formula C12H25FO3Si2
and a molecular weight of 292.50 g/mol. Its IUPAC name is silane;triethoxy(phenyl)silane;hydrofluoride.
Molecular Properties
| Compound Name | silane;triethoxy(phenyl)silane;hydrofluoride |
| PubChem CID | 174494492 |
| Molecular Formula | C12H25FO3Si2 |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | silane;triethoxy(phenyl)silane;hydrofluoride |
| SMILES | CCO[Si](OCC)(OCC)c1ccccc1.F.[SiH4] |
| InChI | InChI=1S/C12H20O3Si.FH.H4Si/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12;;/h7-11H,4-6H2,1-3H3;1H;1H4 |
| InChIKey | CXKHUTOPUBMKPU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze silane;triethoxy(phenyl)silane;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silane;triethoxy(phenyl)silane;hydrofluoride?
The IUPAC name of silane;triethoxy(phenyl)silane;hydrofluoride (CID 174494492) is silane;triethoxy(phenyl)silane;hydrofluoride.
What is the SMILES notation for silane;triethoxy(phenyl)silane;hydrofluoride?
The canonical SMILES for silane;triethoxy(phenyl)silane;hydrofluoride is CCO[Si](OCC)(OCC)c1ccccc1.F.[SiH4].
What is the InChIKey of silane;triethoxy(phenyl)silane;hydrofluoride?
The InChIKey is CXKHUTOPUBMKPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3Si.FH.H4Si/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12;;/h7-11H,4-6H2,1-3H3;1H;1H4.
What are the key properties of silane;triethoxy(phenyl)silane;hydrofluoride?
silane;triethoxy(phenyl)silane;hydrofluoride has a molecular weight of 292.50 g/mol, XLogP of 0.64, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for silane;triethoxy(phenyl)silane;hydrofluoride is sourced from PubChem (CID 174494492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).