About propan-2-yl azepine-1-carboxylate;hydrochloride
propan-2-yl azepine-1-carboxylate;hydrochloride (PubChem CID 174494897) has the molecular formula C10H14ClNO2
and a molecular weight of 215.68 g/mol. Its IUPAC name is propan-2-yl azepine-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | propan-2-yl azepine-1-carboxylate;hydrochloride |
| PubChem CID | 174494897 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | propan-2-yl azepine-1-carboxylate;hydrochloride |
| SMILES | CC(C)OC(=O)N1C=CC=CC=C1.Cl |
| InChI | InChI=1S/C10H13NO2.ClH/c1-9(2)13-10(12)11-7-5-3-4-6-8-11;/h3-9H,1-2H3;1H |
| InChIKey | UTPJSHRNMCJMPD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-2-yl azepine-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl azepine-1-carboxylate;hydrochloride?
The IUPAC name of propan-2-yl azepine-1-carboxylate;hydrochloride (CID 174494897) is propan-2-yl azepine-1-carboxylate;hydrochloride.
What is the SMILES notation for propan-2-yl azepine-1-carboxylate;hydrochloride?
The canonical SMILES for propan-2-yl azepine-1-carboxylate;hydrochloride is CC(C)OC(=O)N1C=CC=CC=C1.Cl.
What is the InChIKey of propan-2-yl azepine-1-carboxylate;hydrochloride?
The InChIKey is UTPJSHRNMCJMPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2.ClH/c1-9(2)13-10(12)11-7-5-3-4-6-8-11;/h3-9H,1-2H3;1H.
What are the key properties of propan-2-yl azepine-1-carboxylate;hydrochloride?
propan-2-yl azepine-1-carboxylate;hydrochloride has a molecular weight of 215.68 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl azepine-1-carboxylate;hydrochloride is sourced from PubChem (CID 174494897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).